C15H20N2O3 — CID 115007906
7-methoxy-2-methyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid (PubChem CID 115007906) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 7-methoxy-2-methyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid.
| Compound Name | 7-methoxy-2-methyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid |
|---|---|
| PubChem CID | 115007906 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 7-methoxy-2-methyl-3,4,4a,5,10,10a-hexahydro-1H-benzo[b][1,6]naphthyridine-10-carboxylic acid |
| SMILES | COc1ccc2c(c1)NC1CCN(C)CC1C2C(=O)O |
| InChI | InChI=1S/C15H20N2O3/c1-17-6-5-12-11(8-17)14(15(18)19)10-4-3-9(20-2)7-13(10)16-12/h3-4,7,11-12,14,16H,5-6,8H2,1-2H3,(H,18,19) |
| InChIKey | XQXUCYOGXXHIOC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |