C11H15NO2 — CID 82275550
4,7-dimethoxy-1,2,3,4-tetrahydroquinoline (PubChem CID 82275550) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 4,7-dimethoxy-1,2,3,4-tetrahydroquinoline.
| Compound Name | 4,7-dimethoxy-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 82275550 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 4,7-dimethoxy-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1ccc2c(c1)NCCC2OC |
| InChI | InChI=1S/C11H15NO2/c1-13-8-3-4-9-10(7-8)12-6-5-11(9)14-2/h3-4,7,11-12H,5-6H2,1-2H3 |
| InChIKey | QNQLZNMNCBHQOU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |