C13H19NO2 — CID 84623888
6-methoxy-4-(2-methoxyethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 84623888) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 6-methoxy-4-(2-methoxyethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 6-methoxy-4-(2-methoxyethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 84623888 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 6-methoxy-4-(2-methoxyethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | COCCC1CCNc2ccc(OC)cc21 |
| InChI | InChI=1S/C13H19NO2/c1-15-8-6-10-5-7-14-13-4-3-11(16-2)9-12(10)13/h3-4,9-10,14H,5-8H2,1-2H3 |
| InChIKey | XDZVAKGDMYDWJG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|