C24H26N2O5 — CID 90116872
2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-5-(3-methoxyphenyl)-4,5-dioxopentanoic acid (PubChem CID 90116872) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-5-(3-methoxyphenyl)-4,5-dioxopentanoic acid.
| Compound Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-5-(3-methoxyphenyl)-4,5-dioxopentanoic acid |
|---|---|
| PubChem CID | 90116872 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-5-(3-methoxyphenyl)-4,5-dioxopentanoic acid |
| SMILES | COc1cccc(C(=O)C(=O)CC(N)(C(=O)O)C2c3ccccc3N[C@@H]3CCC[C@H]23)c1 |
| InChI | InChI=1S/C24H26N2O5/c1-31-15-7-4-6-14(12-15)22(28)20(27)13-24(25,23(29)30)21-16-8-2-3-10-18(16)26-19-11-5-9-17(19)21/h2-4,6-8,10,12,17,19,21,26H,5,9,11,13,25H2,1H3,(H,29,30)/t17-,19+,21?,24?/m0/s1 |
| InChIKey | FRWYVGLKPCMLOF-DXVBNTHHSA-N |
| XLogP | 3.00 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|