C23H22F2N2O4 — CID 90117180
2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-5-(2,4-difluorophenyl)-4,5-dioxopentanoic acid (PubChem CID 90117180) has the molecular formula C23H22F2N2O4 and a molecular weight of 428.44 g/mol. Its IUPAC name is 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-5-(2,4-difluorophenyl)-4,5-dioxopentanoic acid.
| Compound Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-5-(2,4-difluorophenyl)-4,5-dioxopentanoic acid |
|---|---|
| PubChem CID | 90117180 |
| Molecular Formula | C23H22F2N2O4 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-5-(2,4-difluorophenyl)-4,5-dioxopentanoic acid |
| SMILES | NC(CC(=O)C(=O)c1ccc(F)cc1F)(C(=O)O)C1c2ccccc2N[C@@H]2CCC[C@H]12 |
| InChI | InChI=1S/C23H22F2N2O4/c24-12-8-9-13(16(25)10-12)21(29)19(28)11-23(26,22(30)31)20-14-4-1-2-6-17(14)27-18-7-3-5-15(18)20/h1-2,4,6,8-10,15,18,20,27H,3,5,7,11,26H2,(H,30,31)/t15-,18+,20?,23?/m0/s1 |
| InChIKey | XJVZZBGWTOPHMB-MWXZOQLHSA-N |
| XLogP | 3.27 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|