C24H26N2O4 — CID 90117348
2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-4,5-dioxo-6-phenylhexanoic acid (PubChem CID 90117348) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-4,5-dioxo-6-phenylhexanoic acid.
| Compound Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-4,5-dioxo-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 90117348 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-4,5-dioxo-6-phenylhexanoic acid |
| SMILES | NC(CC(=O)C(=O)Cc1ccccc1)(C(=O)O)C1c2ccccc2N[C@@H]2CCC[C@H]12 |
| InChI | InChI=1S/C24H26N2O4/c25-24(23(29)30,14-21(28)20(27)13-15-7-2-1-3-8-15)22-16-9-4-5-11-18(16)26-19-12-6-10-17(19)22/h1-5,7-9,11,17,19,22,26H,6,10,12-14,25H2,(H,29,30)/t17-,19+,22?,24?/m0/s1 |
| InChIKey | CRQHVVCATFUABS-RKHDHNBJSA-N |
| XLogP | 2.92 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|