C27H31N3O4 — CID 71140396
2-(2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-5-(benzylamino)-2-(cyclopropylamino)-4,5-dioxopentanoic acid (PubChem CID 71140396) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is 2-(2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-5-(benzylamino)-2-(cyclopropylamino)-4,5-dioxopentanoic acid.
| Compound Name | 2-(2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-5-(benzylamino)-2-(cyclopropylamino)-4,5-dioxopentanoic acid |
|---|---|
| PubChem CID | 71140396 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 2-(2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl)-5-(benzylamino)-2-(cyclopropylamino)-4,5-dioxopentanoic acid |
| SMILES | O=C(CC(NC1CC1)(C(=O)O)C1c2ccccc2NC2CCCC21)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H31N3O4/c31-23(25(32)28-16-17-7-2-1-3-8-17)15-27(26(33)34,30-18-13-14-18)24-19-9-4-5-11-21(19)29-22-12-6-10-20(22)24/h1-5,7-9,11,18,20,22,24,29-30H,6,10,12-16H2,(H,28,32)(H,33,34) |
| InChIKey | LIEZOYFOYSBQPB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|