C18H26N2O — CID 86810383
N-butyl-1,2,3,4,4a,9,9a,10-octahydroacridine-9-carboxamide (PubChem CID 86810383) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is N-butyl-1,2,3,4,4a,9,9a,10-octahydroacridine-9-carboxamide.
| Compound Name | N-butyl-1,2,3,4,4a,9,9a,10-octahydroacridine-9-carboxamide |
|---|---|
| PubChem CID | 86810383 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-butyl-1,2,3,4,4a,9,9a,10-octahydroacridine-9-carboxamide |
| SMILES | CCCCNC(=O)C1c2ccccc2NC2CCCCC21 |
| InChI | InChI=1S/C18H26N2O/c1-2-3-12-19-18(21)17-13-8-4-6-10-15(13)20-16-11-7-5-9-14(16)17/h4,6,8,10,14,16-17,20H,2-3,5,7,9,11-12H2,1H3,(H,19,21) |
| InChIKey | QXJQLDDLCKBUQH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|