C16H25N3O — CID 165476732
1-butyl-3-(2,3,4,5-tetrahydro-1H-1-benzazepin-2-ylmethyl)urea (PubChem CID 165476732) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 1-butyl-3-(2,3,4,5-tetrahydro-1H-1-benzazepin-2-ylmethyl)urea.
| Compound Name | 1-butyl-3-(2,3,4,5-tetrahydro-1H-1-benzazepin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 165476732 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 1-butyl-3-(2,3,4,5-tetrahydro-1H-1-benzazepin-2-ylmethyl)urea |
| SMILES | CCCCNC(=O)NCC1CCCc2ccccc2N1 |
| InChI | InChI=1S/C16H25N3O/c1-2-3-11-17-16(20)18-12-14-9-6-8-13-7-4-5-10-15(13)19-14/h4-5,7,10,14,19H,2-3,6,8-9,11-12H2,1H3,(H2,17,18,20) |
| InChIKey | BNWXAHPGOSYPQY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|