C16H18N4O — CID 95146009
1-pyridin-2-yl-3-[[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]methyl]urea (PubChem CID 95146009) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-pyridin-2-yl-3-[[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]methyl]urea.
| Compound Name | 1-pyridin-2-yl-3-[[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]methyl]urea |
|---|---|
| PubChem CID | 95146009 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-pyridin-2-yl-3-[[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]methyl]urea |
| SMILES | O=C(NC[C@@H]1CCc2ccccc2N1)Nc1ccccn1 |
| InChI | InChI=1S/C16H18N4O/c21-16(20-15-7-3-4-10-17-15)18-11-13-9-8-12-5-1-2-6-14(12)19-13/h1-7,10,13,19H,8-9,11H2,(H2,17,18,20,21)/t13-/m0/s1 |
| InChIKey | CRNCTCFWNIIVRE-ZDUSSCGKSA-N |
| XLogP | 2.63 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |