C15H19NO3 — CID 15445664
N-benzyl-5,5-dimethyl-2,4-dioxohexanamide (PubChem CID 15445664) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-benzyl-5,5-dimethyl-2,4-dioxohexanamide.
| Compound Name | N-benzyl-5,5-dimethyl-2,4-dioxohexanamide |
|---|---|
| PubChem CID | 15445664 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-benzyl-5,5-dimethyl-2,4-dioxohexanamide |
| SMILES | CC(C)(C)C(=O)CC(=O)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C15H19NO3/c1-15(2,3)13(18)9-12(17)14(19)16-10-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3,(H,16,19) |
| InChIKey | ZFQWIQUXWZLCEO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|