About N-benzylcarbamate;trimethylazanium
N-benzylcarbamate;trimethylazanium (PubChem CID 66870081) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is N-benzylcarbamate;trimethylazanium.
Molecular Properties
| Compound Name | N-benzylcarbamate;trimethylazanium |
| PubChem CID | 66870081 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N-benzylcarbamate;trimethylazanium |
| SMILES | C[NH+](C)C.O=C([O-])NCc1ccccc1 |
| InChI | InChI=1S/C8H9NO2.C3H9N/c10-8(11)9-6-7-4-2-1-3-5-7;1-4(2)3/h1-5,9H,6H2,(H,10,11);1-3H3 |
| InChIKey | ALAPCFSRESIUHV-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 56.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzylcarbamate;trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylcarbamate;trimethylazanium?
The IUPAC name of N-benzylcarbamate;trimethylazanium (CID 66870081) is N-benzylcarbamate;trimethylazanium.
What is the SMILES notation for N-benzylcarbamate;trimethylazanium?
The canonical SMILES for N-benzylcarbamate;trimethylazanium is C[NH+](C)C.O=C([O-])NCc1ccccc1.
What is the InChIKey of N-benzylcarbamate;trimethylazanium?
The InChIKey is ALAPCFSRESIUHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2.C3H9N/c10-8(11)9-6-7-4-2-1-3-5-7;1-4(2)3/h1-5,9H,6H2,(H,10,11);1-3H3.
What are the key properties of N-benzylcarbamate;trimethylazanium?
N-benzylcarbamate;trimethylazanium has a molecular weight of 210.28 g/mol, XLogP of -1.12, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylcarbamate;trimethylazanium is sourced from PubChem (CID 66870081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).