C12H16N2O — CID 19782497
4-methoxy-8,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene (PubChem CID 19782497) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-methoxy-8,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene.
| Compound Name | 4-methoxy-8,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 19782497 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 4-methoxy-8,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)C1CCNC(C1)N2 |
| InChI | InChI=1S/C12H16N2O/c1-15-9-2-3-11-10(7-9)8-4-5-13-12(6-8)14-11/h2-3,7-8,12-14H,4-6H2,1H3 |
| InChIKey | JPTOBNBFLKDIAV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|