About 4-methoxy-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene
4-methoxy-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 14857735) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 4-methoxy-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene.
Analyze 4-methoxy-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene?
The IUPAC name of 4-methoxy-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene (CID 14857735) is 4-methoxy-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene.
What is the SMILES notation for 4-methoxy-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene?
The canonical SMILES for 4-methoxy-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene is COc1ccc2c(c1)C1CCNC2C1.
What is the InChIKey of 4-methoxy-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene?
The InChIKey is MWMITLKZUPSAQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-14-9-2-3-10-11(7-9)8-4-5-13-12(10)6-8/h2-3,7-8,12-13H,4-6H2,1H3.
What are the key properties of 4-methoxy-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene?
4-methoxy-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene has a molecular weight of 189.26 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene is sourced from PubChem (CID 14857735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).