C26H26F2N2O3 — CID 102457906
benzyl N-[(2S,4S)-2-[difluoro-(4-methylphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]carbamate (PubChem CID 102457906) has the molecular formula C26H26F2N2O3 and a molecular weight of 452.50 g/mol. Its IUPAC name is benzyl N-[(2S,4S)-2-[difluoro-(4-methylphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]carbamate.
| Compound Name | benzyl N-[(2S,4S)-2-[difluoro-(4-methylphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]carbamate |
|---|---|
| PubChem CID | 102457906 |
| Molecular Formula | C26H26F2N2O3 |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | benzyl N-[(2S,4S)-2-[difluoro-(4-methylphenyl)methyl]-6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]carbamate |
| SMILES | COc1ccc2c(c1)[C@@H](NC(=O)OCc1ccccc1)C[C@@H](C(F)(F)c1ccc(C)cc1)N2 |
| InChI | InChI=1S/C26H26F2N2O3/c1-17-8-10-19(11-9-17)26(27,28)24-15-23(21-14-20(32-2)12-13-22(21)29-24)30-25(31)33-16-18-6-4-3-5-7-18/h3-14,23-24,29H,15-16H2,1-2H3,(H,30,31)/t23-,24-/m0/s1 |
| InChIKey | RLRRDTFDIBNEFC-ZEQRLZLVSA-N |
| XLogP | 5.95 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|