C20H24N2O3 — CID 154717658
benzyl N-[(2R,4S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]carbamate (PubChem CID 154717658) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is benzyl N-[(2R,4S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]carbamate.
| Compound Name | benzyl N-[(2R,4S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]carbamate |
|---|---|
| PubChem CID | 154717658 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | benzyl N-[(2R,4S)-2-ethyl-6-methoxy-1,2,3,4-tetrahydroquinolin-4-yl]carbamate |
| SMILES | CC[C@@H]1C[C@H](NC(=O)OCc2ccccc2)c2cc(OC)ccc2N1 |
| InChI | InChI=1S/C20H24N2O3/c1-3-15-11-19(17-12-16(24-2)9-10-18(17)21-15)22-20(23)25-13-14-7-5-4-6-8-14/h4-10,12,15,19,21H,3,11,13H2,1-2H3,(H,22,23)/t15-,19+/m1/s1 |
| InChIKey | LSPVHWRWJRWCQH-BEFAXECRSA-N |
| XLogP | 4.26 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|