C21H24N2O5 — CID 12016963
methyl (2R,4S)-6-methoxy-2-methyl-4-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydroquinoline-7-carboxylate (PubChem CID 12016963) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is methyl (2R,4S)-6-methoxy-2-methyl-4-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydroquinoline-7-carboxylate.
| Compound Name | methyl (2R,4S)-6-methoxy-2-methyl-4-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydroquinoline-7-carboxylate |
|---|---|
| PubChem CID | 12016963 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | methyl (2R,4S)-6-methoxy-2-methyl-4-(phenylmethoxycarbonylamino)-1,2,3,4-tetrahydroquinoline-7-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1OC)[C@@H](NC(=O)OCc1ccccc1)C[C@@H](C)N2 |
| InChI | InChI=1S/C21H24N2O5/c1-13-9-17(23-21(25)28-12-14-7-5-4-6-8-14)15-11-19(26-2)16(20(24)27-3)10-18(15)22-13/h4-8,10-11,13,17,22H,9,12H2,1-3H3,(H,23,25)/t13-,17+/m1/s1 |
| InChIKey | GXNOVJWASHEMQY-DYVFJYSZSA-N |
| XLogP | 3.65 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|