C22H25F2NO3 — CID 71052472
benzyl N-[(3S)-3-[2,2-difluoro-2-(4-methylphenyl)ethoxy]cyclopentyl]carbamate (PubChem CID 71052472) has the molecular formula C22H25F2NO3 and a molecular weight of 389.44 g/mol. Its IUPAC name is benzyl N-[(3S)-3-[2,2-difluoro-2-(4-methylphenyl)ethoxy]cyclopentyl]carbamate.
| Compound Name | benzyl N-[(3S)-3-[2,2-difluoro-2-(4-methylphenyl)ethoxy]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 71052472 |
| Molecular Formula | C22H25F2NO3 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | benzyl N-[(3S)-3-[2,2-difluoro-2-(4-methylphenyl)ethoxy]cyclopentyl]carbamate |
| SMILES | Cc1ccc(C(F)(F)CO[C@H]2CCC(NC(=O)OCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C22H25F2NO3/c1-16-7-9-18(10-8-16)22(23,24)15-28-20-12-11-19(13-20)25-21(26)27-14-17-5-3-2-4-6-17/h2-10,19-20H,11-15H2,1H3,(H,25,26)/t19?,20-/m0/s1 |
| InChIKey | ZAYBWDQHPOZMJC-ANYOKISRSA-N |
| XLogP | 4.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |