C29H31NO3 — CID 58812735
benzyl N-[3-[(E)-2-(4-methylphenyl)-3-phenylprop-2-enoxy]cyclopentyl]carbamate (PubChem CID 58812735) has the molecular formula C29H31NO3 and a molecular weight of 441.57 g/mol. Its IUPAC name is benzyl N-[3-[(E)-2-(4-methylphenyl)-3-phenylprop-2-enoxy]cyclopentyl]carbamate.
| Compound Name | benzyl N-[3-[(E)-2-(4-methylphenyl)-3-phenylprop-2-enoxy]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 58812735 |
| Molecular Formula | C29H31NO3 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | benzyl N-[3-[(E)-2-(4-methylphenyl)-3-phenylprop-2-enoxy]cyclopentyl]carbamate |
| SMILES | Cc1ccc(/C(=C\c2ccccc2)COC2CCC(NC(=O)OCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C29H31NO3/c1-22-12-14-25(15-13-22)26(18-23-8-4-2-5-9-23)21-32-28-17-16-27(19-28)30-29(31)33-20-24-10-6-3-7-11-24/h2-15,18,27-28H,16-17,19-21H2,1H3,(H,30,31)/b26-18- |
| InChIKey | CEIAQCIADVLQOE-ITYLOYPMSA-N |
| XLogP | 6.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|