C23H26BrNO3 — CID 58812770
benzyl N-[4-[(Z)-2-bromo-3-phenylprop-2-enoxy]cyclohexyl]carbamate (PubChem CID 58812770) has the molecular formula C23H26BrNO3 and a molecular weight of 444.37 g/mol. Its IUPAC name is benzyl N-[4-[(Z)-2-bromo-3-phenylprop-2-enoxy]cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[(Z)-2-bromo-3-phenylprop-2-enoxy]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 58812770 |
| Molecular Formula | C23H26BrNO3 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | benzyl N-[4-[(Z)-2-bromo-3-phenylprop-2-enoxy]cyclohexyl]carbamate |
| SMILES | O=C(NC1CCC(OC/C(Br)=C/c2ccccc2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C23H26BrNO3/c24-20(15-18-7-3-1-4-8-18)17-27-22-13-11-21(12-14-22)25-23(26)28-16-19-9-5-2-6-10-19/h1-10,15,21-22H,11-14,16-17H2,(H,25,26)/b20-15- |
| InChIKey | BEJXMRZCZUGOSW-HKWRFOASSA-N |
| XLogP | 5.68 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |