C22H26FNO4 — CID 58812750
benzyl N-[4-[2-(2-fluorophenyl)-2-hydroxyethoxy]cyclohexyl]carbamate (PubChem CID 58812750) has the molecular formula C22H26FNO4 and a molecular weight of 387.45 g/mol. Its IUPAC name is benzyl N-[4-[2-(2-fluorophenyl)-2-hydroxyethoxy]cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[2-(2-fluorophenyl)-2-hydroxyethoxy]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 58812750 |
| Molecular Formula | C22H26FNO4 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | benzyl N-[4-[2-(2-fluorophenyl)-2-hydroxyethoxy]cyclohexyl]carbamate |
| SMILES | O=C(NC1CCC(OCC(O)c2ccccc2F)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C22H26FNO4/c23-20-9-5-4-8-19(20)21(25)15-27-18-12-10-17(11-13-18)24-22(26)28-14-16-6-2-1-3-7-16/h1-9,17-18,21,25H,10-15H2,(H,24,26) |
| InChIKey | UKIFSYUWRFGHED-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |