C24H19F3N2O3S — CID 90051451
benzyl N-[(3S)-2-sulfanylidene-6-[3-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-quinolin-3-yl]carbamate (PubChem CID 90051451) has the molecular formula C24H19F3N2O3S and a molecular weight of 472.49 g/mol. Its IUPAC name is benzyl N-[(3S)-2-sulfanylidene-6-[3-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-quinolin-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-2-sulfanylidene-6-[3-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-quinolin-3-yl]carbamate |
|---|---|
| PubChem CID | 90051451 |
| Molecular Formula | C24H19F3N2O3S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | benzyl N-[(3S)-2-sulfanylidene-6-[3-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-quinolin-3-yl]carbamate |
| SMILES | O=C(N[C@H]1Cc2cc(Oc3cccc(C(F)(F)F)c3)ccc2NC1=S)OCc1ccccc1 |
| InChI | InChI=1S/C24H19F3N2O3S/c25-24(26,27)17-7-4-8-18(13-17)32-19-9-10-20-16(11-19)12-21(22(33)28-20)29-23(30)31-14-15-5-2-1-3-6-15/h1-11,13,21H,12,14H2,(H,28,33)(H,29,30)/t21-/m0/s1 |
| InChIKey | UVRKGBFQTWLCHD-NRFANRHFSA-N |
| XLogP | 6.09 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|