C18H16N2O4 — CID 118564381
benzyl N-(2,5-dioxo-3,4-dihydro-1H-1-benzazepin-3-yl)carbamate (PubChem CID 118564381) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is benzyl N-(2,5-dioxo-3,4-dihydro-1H-1-benzazepin-3-yl)carbamate.
| Compound Name | benzyl N-(2,5-dioxo-3,4-dihydro-1H-1-benzazepin-3-yl)carbamate |
|---|---|
| PubChem CID | 118564381 |
| Molecular Formula | C18H16N2O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | benzyl N-(2,5-dioxo-3,4-dihydro-1H-1-benzazepin-3-yl)carbamate |
| SMILES | O=C(NC1CC(=O)c2ccccc2NC1=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H16N2O4/c21-16-10-15(17(22)19-14-9-5-4-8-13(14)16)20-18(23)24-11-12-6-2-1-3-7-12/h1-9,15H,10-11H2,(H,19,22)(H,20,23) |
| InChIKey | NTOGKFZLQRAFQT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |