C15H16N2O6 — CID 12047333
[2,6-dioxo-5-(phenylmethoxycarbonylamino)piperidin-3-yl] acetate (PubChem CID 12047333) has the molecular formula C15H16N2O6 and a molecular weight of 320.30 g/mol. Its IUPAC name is [2,6-dioxo-5-(phenylmethoxycarbonylamino)piperidin-3-yl] acetate.
| Compound Name | [2,6-dioxo-5-(phenylmethoxycarbonylamino)piperidin-3-yl] acetate |
|---|---|
| PubChem CID | 12047333 |
| Molecular Formula | C15H16N2O6 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [2,6-dioxo-5-(phenylmethoxycarbonylamino)piperidin-3-yl] acetate |
| SMILES | CC(=O)OC1CC(NC(=O)OCc2ccccc2)C(=O)NC1=O |
| InChI | InChI=1S/C15H16N2O6/c1-9(18)23-12-7-11(13(19)17-14(12)20)16-15(21)22-8-10-5-3-2-4-6-10/h2-6,11-12H,7-8H2,1H3,(H,16,21)(H,17,19,20) |
| InChIKey | SIIJOEXRBXMSSN-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|