C17H18N2O4 — CID 122212057
benzyl N-[(3aR,4S,7aR)-6-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]carbamate (PubChem CID 122212057) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is benzyl N-[(3aR,4S,7aR)-6-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]carbamate.
| Compound Name | benzyl N-[(3aR,4S,7aR)-6-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]carbamate |
|---|---|
| PubChem CID | 122212057 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | benzyl N-[(3aR,4S,7aR)-6-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]carbamate |
| SMILES | CC1=C[C@H](NC(=O)OCc2ccccc2)[C@@H]2C(=O)NC(=O)[C@@H]2C1 |
| InChI | InChI=1S/C17H18N2O4/c1-10-7-12-14(16(21)19-15(12)20)13(8-10)18-17(22)23-9-11-5-3-2-4-6-11/h2-6,8,12-14H,7,9H2,1H3,(H,18,22)(H,19,20,21)/t12-,13+,14-/m1/s1 |
| InChIKey | ZEWALMOZANDJEW-HZSPNIEDSA-N |
| XLogP | 1.52 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|