C16H13F3N2O2 — CID 123282552
3-amino-6-[3-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 123282552) has the molecular formula C16H13F3N2O2 and a molecular weight of 322.29 g/mol. Its IUPAC name is 3-amino-6-[3-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 3-amino-6-[3-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 123282552 |
| Molecular Formula | C16H13F3N2O2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 3-amino-6-[3-(trifluoromethyl)phenoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | NC1Cc2cc(Oc3cccc(C(F)(F)F)c3)ccc2NC1=O |
| InChI | InChI=1S/C16H13F3N2O2/c17-16(18,19)10-2-1-3-11(8-10)23-12-4-5-14-9(6-12)7-13(20)15(22)21-14/h1-6,8,13H,7,20H2,(H,21,22) |
| InChIKey | ATPUYFJDBSKDPH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |