C13H11F3N2O — CID 126478251
5-[3-(trifluoromethyl)phenoxy]benzene-1,3-diamine (PubChem CID 126478251) has the molecular formula C13H11F3N2O and a molecular weight of 268.24 g/mol. Its IUPAC name is 5-[3-(trifluoromethyl)phenoxy]benzene-1,3-diamine.
| Compound Name | 5-[3-(trifluoromethyl)phenoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 126478251 |
| Molecular Formula | C13H11F3N2O |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5-[3-(trifluoromethyl)phenoxy]benzene-1,3-diamine |
| SMILES | Nc1cc(N)cc(Oc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C13H11F3N2O/c14-13(15,16)8-2-1-3-11(4-8)19-12-6-9(17)5-10(18)7-12/h1-7H,17-18H2 |
| InChIKey | XSITYSINAIQBJI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|