C20H19NO2 — CID 122390233
(3aS,4S,9bR)-8-methoxy-2-methyl-4-phenyl-3a,4,5,9b-tetrahydrocyclopenta[c]quinolin-3-one (PubChem CID 122390233) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (3aS,4S,9bR)-8-methoxy-2-methyl-4-phenyl-3a,4,5,9b-tetrahydrocyclopenta[c]quinolin-3-one.
| Compound Name | (3aS,4S,9bR)-8-methoxy-2-methyl-4-phenyl-3a,4,5,9b-tetrahydrocyclopenta[c]quinolin-3-one |
|---|---|
| PubChem CID | 122390233 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (3aS,4S,9bR)-8-methoxy-2-methyl-4-phenyl-3a,4,5,9b-tetrahydrocyclopenta[c]quinolin-3-one |
| SMILES | COc1ccc2c(c1)[C@@H]1C=C(C)C(=O)[C@@H]1[C@@H](c1ccccc1)N2 |
| InChI | InChI=1S/C20H19NO2/c1-12-10-16-15-11-14(23-2)8-9-17(15)21-19(18(16)20(12)22)13-6-4-3-5-7-13/h3-11,16,18-19,21H,1-2H3/t16-,18-,19+/m0/s1 |
| InChIKey | FYRSXJCZAQIURA-YTQUADARSA-N |
| XLogP | 4.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'} |
|---|