C11H15NO — CID 82275853
4-methoxy-2-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 82275853) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-methoxy-2-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 4-methoxy-2-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 82275853 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 4-methoxy-2-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | COC1CC(C)Nc2ccccc21 |
| InChI | InChI=1S/C11H15NO/c1-8-7-11(13-2)9-5-3-4-6-10(9)12-8/h3-6,8,11-12H,7H2,1-2H3 |
| InChIKey | CCXAHMULNABIRB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |