C14H21N — CID 106780808
4-butan-2-yl-2-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 106780808) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 4-butan-2-yl-2-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 4-butan-2-yl-2-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106780808 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 4-butan-2-yl-2-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CCC(C)C1CC(C)Nc2ccccc21 |
| InChI | InChI=1S/C14H21N/c1-4-10(2)13-9-11(3)15-14-8-6-5-7-12(13)14/h5-8,10-11,13,15H,4,9H2,1-3H3 |
| InChIKey | KXUXQPJWWBOIGB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |