C16H24 — CID 123233367
(1S,2S,4S)-4-[(2R)-butan-2-yl]-1,2-dimethyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 123233367) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is (1S,2S,4S)-4-[(2R)-butan-2-yl]-1,2-dimethyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1S,2S,4S)-4-[(2R)-butan-2-yl]-1,2-dimethyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 123233367 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | (1S,2S,4S)-4-[(2R)-butan-2-yl]-1,2-dimethyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC[C@@H](C)[C@@H]1C[C@H](C)[C@H](C)c2ccccc21 |
| InChI | InChI=1S/C16H24/c1-5-11(2)16-10-12(3)13(4)14-8-6-7-9-15(14)16/h6-9,11-13,16H,5,10H2,1-4H3/t11-,12+,13+,16+/m1/s1 |
| InChIKey | RUDGJUZSNUTCEC-DVZHBHJUSA-N |
| XLogP | 4.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |