C14H20S — CID 170048943
2-(3,4-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)ethanethiol (PubChem CID 170048943) has the molecular formula C14H20S and a molecular weight of 220.38 g/mol. Its IUPAC name is 2-(3,4-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)ethanethiol.
| Compound Name | 2-(3,4-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)ethanethiol |
|---|---|
| PubChem CID | 170048943 |
| Molecular Formula | C14H20S |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-(3,4-dimethyl-1,2,3,4-tetrahydronaphthalen-1-yl)ethanethiol |
| SMILES | CC1CC(CCS)c2ccccc2C1C |
| InChI | InChI=1S/C14H20S/c1-10-9-12(7-8-15)14-6-4-3-5-13(14)11(10)2/h3-6,10-12,15H,7-9H2,1-2H3 |
| InChIKey | YJLVQDMIAIEHEH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|