C12H16 — CID 58834632
(1S,3R)-1,2,3-trimethyl-2,3-dihydro-1H-indene (PubChem CID 58834632) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is (1S,3R)-1,2,3-trimethyl-2,3-dihydro-1H-indene.
| Compound Name | (1S,3R)-1,2,3-trimethyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 58834632 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | (1S,3R)-1,2,3-trimethyl-2,3-dihydro-1H-indene |
| SMILES | CC1[C@H](C)c2ccccc2[C@@H]1C |
| InChI | InChI=1S/C12H16/c1-8-9(2)11-6-4-5-7-12(11)10(8)3/h4-10H,1-3H3/t8?,9-,10+ |
| InChIKey | VTFCTROSJUESLK-PBINXNQUSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |