C19H20O — CID 10515770
(15S,17R)-15,17-dimethyltetracyclo[6.6.3.02,7.09,14]heptadeca-2,4,6,9,11,13-hexaen-16-ol (PubChem CID 10515770) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is (15S,17R)-15,17-dimethyltetracyclo[6.6.3.02,7.09,14]heptadeca-2,4,6,9,11,13-hexaen-16-ol.
| Compound Name | (15S,17R)-15,17-dimethyltetracyclo[6.6.3.02,7.09,14]heptadeca-2,4,6,9,11,13-hexaen-16-ol |
|---|---|
| PubChem CID | 10515770 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (15S,17R)-15,17-dimethyltetracyclo[6.6.3.02,7.09,14]heptadeca-2,4,6,9,11,13-hexaen-16-ol |
| SMILES | C[C@@H]1C2c3ccccc3C(c3ccccc32)[C@H](C)C1O |
| InChI | InChI=1S/C19H20O/c1-11-17-13-7-3-5-9-15(13)18(12(2)19(11)20)16-10-6-4-8-14(16)17/h3-12,17-20H,1-2H3/t11-,12+,17?,18?,19? |
| InChIKey | KAESRWOKUBLDPC-FHZQIHQYSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |