C16H14O4 — CID 125496010
(1R,8R,15S,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-3,6,15,16-tetrol (PubChem CID 125496010) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is (1R,8R,15S,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-3,6,15,16-tetrol.
| Compound Name | (1R,8R,15S,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-3,6,15,16-tetrol |
|---|---|
| PubChem CID | 125496010 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (1R,8R,15S,16R)-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-3,6,15,16-tetrol |
| SMILES | Oc1ccc(O)c2c1[C@H]1c3ccccc3[C@H]2[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H14O4/c17-9-5-6-10(18)14-12-8-4-2-1-3-7(8)11(13(9)14)15(19)16(12)20/h1-6,11-12,15-20H/t11-,12-,15-,16+/m1/s1 |
| InChIKey | JMSZTUFDISEGSN-BHTHQVBYSA-N |
| XLogP | 1.41 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|