C20H16 — CID 12885776
pentacyclo[6.6.4.215,18.02,7.09,14]icosa-2,4,6,9,11,13,16,19-octaene (PubChem CID 12885776) has the molecular formula C20H16 and a molecular weight of 256.35 g/mol. Its IUPAC name is pentacyclo[6.6.4.215,18.02,7.09,14]icosa-2,4,6,9,11,13,16,19-octaene.
| Compound Name | pentacyclo[6.6.4.215,18.02,7.09,14]icosa-2,4,6,9,11,13,16,19-octaene |
|---|---|
| PubChem CID | 12885776 |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | pentacyclo[6.6.4.215,18.02,7.09,14]icosa-2,4,6,9,11,13,16,19-octaene |
| SMILES | C1=CC2C=CC1C1c3ccccc3C2c2ccccc21 |
| InChI | InChI=1S/C20H16/c1-2-6-16-15(5-1)19-13-9-11-14(12-10-13)20(16)18-8-4-3-7-17(18)19/h1-14,19-20H |
| InChIKey | MBDPCCJWNQIKGC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|