C22H28N2 — CID 10336156
1-[(15S,16S)-16-[(dimethylamino)methyl]-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]-N,N-dimethylmethanamine (PubChem CID 10336156) has the molecular formula C22H28N2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 1-[(15S,16S)-16-[(dimethylamino)methyl]-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[(15S,16S)-16-[(dimethylamino)methyl]-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 10336156 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 1-[(15S,16S)-16-[(dimethylamino)methyl]-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)C[C@H]1C2c3ccccc3C(c3ccccc32)[C@@H]1CN(C)C |
| InChI | InChI=1S/C22H28N2/c1-23(2)13-19-20(14-24(3)4)22-17-11-7-5-9-15(17)21(19)16-10-6-8-12-18(16)22/h5-12,19-22H,13-14H2,1-4H3/t19-,20-,21?,22?/m1/s1 |
| InChIKey | NZSIQXBYQXDUKE-JTVPBKEVSA-N |
| XLogP | 3.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |