C26H20N2+2 — CID 102426832
(1S,2S,9S,10S)-3,11-diazoniaheptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3,5,7,11,13,15,17,19,21,23,25,27-dodecaene (PubChem CID 102426832) has the molecular formula C26H20N2+2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (1S,2S,9S,10S)-3,11-diazoniaheptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3,5,7,11,13,15,17,19,21,23,25,27-dodecaene.
| Compound Name | (1S,2S,9S,10S)-3,11-diazoniaheptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3,5,7,11,13,15,17,19,21,23,25,27-dodecaene |
|---|---|
| PubChem CID | 102426832 |
| Molecular Formula | C26H20N2+2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (1S,2S,9S,10S)-3,11-diazoniaheptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3,5,7,11,13,15,17,19,21,23,25,27-dodecaene |
| SMILES | c1ccc2c(c1)[C@@H]1c3cccc[n+]3[C@H]2[C@@H]2c3ccccc3[C@H]1[n+]1ccccc12 |
| InChI | InChI=1S/C26H20N2/c1-3-11-19-17(9-1)23-21-13-5-7-15-27(21)25(19)24-18-10-2-4-12-20(18)26(23)28-16-8-6-14-22(24)28/h1-16,23-26H/q+2/t23-,24-,25-,26-/m1/s1 |
| InChIKey | VOOJVHUDCKEBPO-VEYUFSJPSA-N |
| XLogP | 4.04 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|