C26H22N4+2 — CID 102007408
3,11-diazoniaheptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3,5,7,11,13,15,17(22),18,20,23(28),24,26-dodecaene-20,26-diamine (PubChem CID 102007408) has the molecular formula C26H22N4+2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 3,11-diazoniaheptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3,5,7,11,13,15,17(22),18,20,23(28),24,26-dodecaene-20,26-diamine.
| Compound Name | 3,11-diazoniaheptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3,5,7,11,13,15,17(22),18,20,23(28),24,26-dodecaene-20,26-diamine |
|---|---|
| PubChem CID | 102007408 |
| Molecular Formula | C26H22N4+2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 3,11-diazoniaheptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3,5,7,11,13,15,17(22),18,20,23(28),24,26-dodecaene-20,26-diamine |
| SMILES | Nc1ccc2c(c1)C1C3c4ccc(N)cc4C(C2c2cccc[n+]21)[n+]1ccccc13 |
| InChI | InChI=1S/C26H22N4/c27-15-7-9-17-19(13-15)26-24-18-10-8-16(28)14-20(18)25(30-12-4-2-6-22(24)30)23(17)21-5-1-3-11-29(21)26/h1-14,23-26H,27-28H2/q+2 |
| InChIKey | FIZDARRAWKCENM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|