C42H34N4 — CID 144768931
3-N-[4-[4-[4-(N-(3-aminophenyl)anilino)phenyl]phenyl]phenyl]-3-N-phenylbenzene-1,3-diamine (PubChem CID 144768931) has the molecular formula C42H34N4 and a molecular weight of 594.76 g/mol. Its IUPAC name is 3-N-[4-[4-[4-(N-(3-aminophenyl)anilino)phenyl]phenyl]phenyl]-3-N-phenylbenzene-1,3-diamine.
| Compound Name | 3-N-[4-[4-[4-(N-(3-aminophenyl)anilino)phenyl]phenyl]phenyl]-3-N-phenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 144768931 |
| Molecular Formula | C42H34N4 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.28 |
| IUPAC Name | 3-N-[4-[4-[4-(N-(3-aminophenyl)anilino)phenyl]phenyl]phenyl]-3-N-phenylbenzene-1,3-diamine |
| SMILES | Nc1cccc(N(c2ccccc2)c2ccc(-c3ccc(-c4ccc(N(c5ccccc5)c5cccc(N)c5)cc4)cc3)cc2)c1 |
| InChI | InChI=1S/C42H34N4/c43-35-9-7-15-41(29-35)45(37-11-3-1-4-12-37)39-25-21-33(22-26-39)31-17-19-32(20-18-31)34-23-27-40(28-24-34)46(38-13-5-2-6-14-38)42-16-8-10-36(44)30-42/h1-30H,43-44H2 |
| InChIKey | COMHEQKREXTJPV-UHFFFAOYSA-N |
| XLogP | 11.12 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|