C16H12 — CID 98514230
(2R,16R)-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaene (PubChem CID 98514230) has the molecular formula C16H12 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2R,16R)-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaene.
| Compound Name | (2R,16R)-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaene |
|---|---|
| PubChem CID | 98514230 |
| Molecular Formula | C16H12 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (2R,16R)-pentacyclo[7.7.0.02,16.03,8.010,15]hexadeca-3,5,7,10,12,14-hexaene |
| SMILES | c1ccc2c(c1)C1c3ccccc3[C@@H]3C1[C@@H]23 |
| InChI | InChI=1S/C16H12/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)15-14(11)16(13)15/h1-8,13-16H/t13?,14-,15-,16?/m0/s1 |
| InChIKey | RATAQXOLJVRERC-PYBGIAKNSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |