C13H10O — CID 98555823
(2R,3S,4S,8S)-tetracyclo[7.4.0.02,4.03,8]trideca-1(13),5,9,11-tetraen-7-one (PubChem CID 98555823) has the molecular formula C13H10O and a molecular weight of 182.22 g/mol. Its IUPAC name is (2R,3S,4S,8S)-tetracyclo[7.4.0.02,4.03,8]trideca-1(13),5,9,11-tetraen-7-one.
| Compound Name | (2R,3S,4S,8S)-tetracyclo[7.4.0.02,4.03,8]trideca-1(13),5,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 98555823 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | (2R,3S,4S,8S)-tetracyclo[7.4.0.02,4.03,8]trideca-1(13),5,9,11-tetraen-7-one |
| SMILES | O=C1C=C[C@@H]2[C@H]3c4ccccc4[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C13H10O/c14-10-6-5-9-11-7-3-1-2-4-8(7)12(10)13(9)11/h1-6,9,11-13H/t9-,11-,12+,13+/m1/s1 |
| InChIKey | UFMRJSPXCBNNAG-XEZLXBQYSA-N |
| XLogP | 2.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |