C14H12 — CID 98158883
(3S,4S,7S,8S)-hexacyclo[8.4.0.02,7.03,5.04,9.06,8]tetradeca-1(14),10,12-triene (PubChem CID 98158883) has the molecular formula C14H12 and a molecular weight of 180.25 g/mol. Its IUPAC name is (3S,4S,7S,8S)-hexacyclo[8.4.0.02,7.03,5.04,9.06,8]tetradeca-1(14),10,12-triene.
| Compound Name | (3S,4S,7S,8S)-hexacyclo[8.4.0.02,7.03,5.04,9.06,8]tetradeca-1(14),10,12-triene |
|---|---|
| PubChem CID | 98158883 |
| Molecular Formula | C14H12 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (3S,4S,7S,8S)-hexacyclo[8.4.0.02,7.03,5.04,9.06,8]tetradeca-1(14),10,12-triene |
| SMILES | c1ccc2c(c1)C1[C@H]3C4C5[C@H]1[C@H]5C2[C@@H]43 |
| InChI | InChI=1S/C14H12/c1-2-4-6-5(3-1)7-9-11-8(6)12-10(7)14(12)13(9)11/h1-4,7-14H/t7?,8?,9-,10-,11-,12-,13?,14?/m1/s1 |
| InChIKey | YNJHEGQIMPXSPG-CUXBLVMZSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |