C13H12I2 — CID 11201002
(1S,2S,9R,10R,11R,12R)-11,12-diiodotetracyclo[8.2.1.02,9.03,8]trideca-3,5,7-triene (PubChem CID 11201002) has the molecular formula C13H12I2 and a molecular weight of 422.05 g/mol. Its IUPAC name is (1S,2S,9R,10R,11R,12R)-11,12-diiodotetracyclo[8.2.1.02,9.03,8]trideca-3,5,7-triene.
| Compound Name | (1S,2S,9R,10R,11R,12R)-11,12-diiodotetracyclo[8.2.1.02,9.03,8]trideca-3,5,7-triene |
|---|---|
| PubChem CID | 11201002 |
| Molecular Formula | C13H12I2 |
| Molecular Weight | 422.05 g/mol |
| Exact Mass | 421.90 |
| IUPAC Name | (1S,2S,9R,10R,11R,12R)-11,12-diiodotetracyclo[8.2.1.02,9.03,8]trideca-3,5,7-triene |
| SMILES | I[C@H]1[C@H](I)[C@@H]2C[C@H]1[C@H]1c3ccccc3[C@@H]21 |
| InChI | InChI=1S/C13H12I2/c14-12-8-5-9(13(12)15)11-7-4-2-1-3-6(7)10(8)11/h1-4,8-13H,5H2/t8-,9+,10+,11-,12-,13-/m1/s1 |
| InChIKey | FWBNCGJGLJSRCC-KISRQWFGSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.05 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cycloheptane_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|