C13H12Cl2 — CID 22216876
(1R,2R,9S,10S,11S,12S)-11,12-dichlorotetracyclo[8.2.1.02,9.03,8]trideca-3,5,7-triene (PubChem CID 22216876) has the molecular formula C13H12Cl2 and a molecular weight of 239.14 g/mol. Its IUPAC name is (1R,2R,9S,10S,11S,12S)-11,12-dichlorotetracyclo[8.2.1.02,9.03,8]trideca-3,5,7-triene.
| Compound Name | (1R,2R,9S,10S,11S,12S)-11,12-dichlorotetracyclo[8.2.1.02,9.03,8]trideca-3,5,7-triene |
|---|---|
| PubChem CID | 22216876 |
| Molecular Formula | C13H12Cl2 |
| Molecular Weight | 239.14 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | (1R,2R,9S,10S,11S,12S)-11,12-dichlorotetracyclo[8.2.1.02,9.03,8]trideca-3,5,7-triene |
| SMILES | Cl[C@@H]1[C@@H](Cl)[C@@H]2C[C@H]1[C@H]1c3ccccc3[C@@H]21 |
| InChI | InChI=1S/C13H12Cl2/c14-12-8-5-9(13(12)15)11-7-4-2-1-3-6(7)10(8)11/h1-4,8-13H,5H2/t8-,9+,10+,11-,12-,13-/m0/s1 |
| InChIKey | CQVUHABFOFZCQA-QFHDERPTSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.14 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cycloheptane_2', 'substructure': 'N/A'} |
|---|