C15H16O — CID 15625267
[(1S,2S,9R,10R,11S,13R)-12-pentacyclo[8.3.1.02,9.03,8.011,13]tetradeca-3,5,7-trienyl]methanol (PubChem CID 15625267) has the molecular formula C15H16O and a molecular weight of 212.29 g/mol. Its IUPAC name is [(1S,2S,9R,10R,11S,13R)-12-pentacyclo[8.3.1.02,9.03,8.011,13]tetradeca-3,5,7-trienyl]methanol.
| Compound Name | [(1S,2S,9R,10R,11S,13R)-12-pentacyclo[8.3.1.02,9.03,8.011,13]tetradeca-3,5,7-trienyl]methanol |
|---|---|
| PubChem CID | 15625267 |
| Molecular Formula | C15H16O |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | [(1S,2S,9R,10R,11S,13R)-12-pentacyclo[8.3.1.02,9.03,8.011,13]tetradeca-3,5,7-trienyl]methanol |
| SMILES | OCC1[C@@H]2[C@@H]3C[C@@H]([C@H]4c5ccccc5[C@@H]34)[C@H]12 |
| InChI | InChI=1S/C15H16O/c16-6-11-14-9-5-10(15(11)14)13-8-4-2-1-3-7(8)12(9)13/h1-4,9-16H,5-6H2/t9-,10+,11?,12+,13-,14+,15- |
| InChIKey | LIUTUNIPVPSHCA-WTGIQTJSSA-N |
| XLogP | 2.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cycloheptane_2', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_2', 'substructure': 'N/A'} |
|---|