C13H12O4 — CID 11876849
(2R,3R,5S,6R)-tricyclo[5.4.0.02,6]undeca-1(11),7,9-triene-3,5-dicarboxylic acid (PubChem CID 11876849) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is (2R,3R,5S,6R)-tricyclo[5.4.0.02,6]undeca-1(11),7,9-triene-3,5-dicarboxylic acid.
| Compound Name | (2R,3R,5S,6R)-tricyclo[5.4.0.02,6]undeca-1(11),7,9-triene-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 11876849 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (2R,3R,5S,6R)-tricyclo[5.4.0.02,6]undeca-1(11),7,9-triene-3,5-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H](C(=O)O)[C@@H]2c3ccccc3[C@H]21 |
| InChI | InChI=1S/C13H12O4/c14-12(15)8-5-9(13(16)17)11-7-4-2-1-3-6(7)10(8)11/h1-4,8-11H,5H2,(H,14,15)(H,16,17)/t8-,9+,10-,11-/m0/s1 |
| InChIKey | XICWQWQBIJGOQP-VLEAKVRGSA-N |
| XLogP | 1.67 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |