C15H14O — CID 98556362
(3R,5S,6S,8S)-11-methoxyhexacyclo[8.4.0.02,5.03,8.04,7.06,9]tetradeca-1(10),11,13-triene (PubChem CID 98556362) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is (3R,5S,6S,8S)-11-methoxyhexacyclo[8.4.0.02,5.03,8.04,7.06,9]tetradeca-1(10),11,13-triene.
| Compound Name | (3R,5S,6S,8S)-11-methoxyhexacyclo[8.4.0.02,5.03,8.04,7.06,9]tetradeca-1(10),11,13-triene |
|---|---|
| PubChem CID | 98556362 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (3R,5S,6S,8S)-11-methoxyhexacyclo[8.4.0.02,5.03,8.04,7.06,9]tetradeca-1(10),11,13-triene |
| SMILES | COc1cccc2c1C1[C@H]3C4C5[C@H]3C2[C@@H]5[C@@H]14 |
| InChI | InChI=1S/C15H14O/c1-16-6-4-2-3-5-7(6)9-12-10-8(5)11-13(9)15(12)14(10)11/h2-4,8-15H,1H3/t8?,9?,10-,11+,12-,13-,14?,15?/m1/s1 |
| InChIKey | PHICXBGTDAEVRO-WTEGDZJDSA-N |
| XLogP | 2.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |