C15H14O — CID 98159009
(1R,2R,9S,10S,13S,14S)-4-methoxypentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3(8),4,6,11-tetraene (PubChem CID 98159009) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is (1R,2R,9S,10S,13S,14S)-4-methoxypentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3(8),4,6,11-tetraene.
| Compound Name | (1R,2R,9S,10S,13S,14S)-4-methoxypentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3(8),4,6,11-tetraene |
|---|---|
| PubChem CID | 98159009 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (1R,2R,9S,10S,13S,14S)-4-methoxypentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3(8),4,6,11-tetraene |
| SMILES | COc1cccc2c1[C@H]1[C@H]3[C@@H]2[C@H]2C=C[C@@H]2[C@H]13 |
| InChI | InChI=1S/C15H14O/c1-16-10-4-2-3-9-11-7-5-6-8(7)13-14(11)15(13)12(9)10/h2-8,11,13-15H,1H3/t7-,8-,11+,13-,14-,15+/m0/s1 |
| InChIKey | YCSMNJDXPUOOSB-YYBWVHMRSA-N |
| XLogP | 2.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cycloheptane_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|