C16H16O2 — CID 98556349
(1S,2R,9R,10S,13S,14S)-4,7-dimethoxypentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3,5,7,11-tetraene (PubChem CID 98556349) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is (1S,2R,9R,10S,13S,14S)-4,7-dimethoxypentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3,5,7,11-tetraene.
| Compound Name | (1S,2R,9R,10S,13S,14S)-4,7-dimethoxypentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3,5,7,11-tetraene |
|---|---|
| PubChem CID | 98556349 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (1S,2R,9R,10S,13S,14S)-4,7-dimethoxypentacyclo[7.5.0.02,14.03,8.010,13]tetradeca-3,5,7,11-tetraene |
| SMILES | COc1ccc(OC)c2c1[C@@H]1[C@H]3C=C[C@@H]3[C@@H]3[C@@H]2[C@@H]13 |
| InChI | InChI=1S/C16H16O2/c1-17-9-5-6-10(18-2)14-13(9)11-7-3-4-8(7)12-15(11)16(12)14/h3-8,11-12,15-16H,1-2H3/t7-,8-,11-,12-,15-,16-/m0/s1 |
| InChIKey | HAIGLKKQMUZVAS-AVOXNUIRSA-N |
| XLogP | 2.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cycloheptane_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|